* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX165068-001 |
English Synonyms: | WUXIAPPTEC WX165068-010 ; WUXIAPPTEC WX165068-001 ; WUXIAPPTEC WX165068-005 |
MDL Number.: | MFCD17017050 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | BrC1=CN2N=C(N=C2C=C1)N1CCNCC1 |
InChi: | InChI=1S/C10H12BrN5/c11-8-1-2-9-13-10(14-16(9)7-8)15-5-3-12-4-6-15/h1-2,7,12H,3-6H2 |
InChiKey: | InChIKey=GXFVFZOECVTUFJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.