* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX165069-001 |
| English Synonyms: | WUXIAPPTEC WX165069-010 ; WUXIAPPTEC WX165069-005 ; WUXIAPPTEC WX165069-001 |
| MDL Number.: | MFCD17017051 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | BrC1=CC2=C(NCC2C2=NN=CN2)C=C1 |
| InChi: | InChI=1S/C10H9BrN4/c11-6-1-2-9-7(3-6)8(4-12-9)10-13-5-14-15-10/h1-3,5,8,12H,4H2,(H,13,14,15) |
| InChiKey: | InChIKey=URKQPRFDZUFESH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.