* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX165074-001 |
English Synonyms: | WUXIAPPTEC WX165074-005 ; WUXIAPPTEC WX165074-001 ; WUXIAPPTEC WX165074-010 |
MDL Number.: | MFCD17017056 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | BrC1=CN2N=C(N=C2C=C1)C1CNCCN1 |
InChi: | InChI=1S/C10H12BrN5/c11-7-1-2-9-14-10(15-16(9)6-7)8-5-12-3-4-13-8/h1-2,6,8,12-13H,3-5H2 |
InChiKey: | InChIKey=HIKWUUXBLAIUDQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.