Molecular Structure:
CCD No.:CCD03288107
OTAVA-BB 3930326
Formula:C13 H24 N2 O2
MolWeight:240.345
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 3930326 |
| English Synonyms： | OTAVA-BB 3930326 |
| MDL Number.： | MFCD17017058 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CC(C)(C)OC(=O)N1CCCC1C2CCNC2 |
| InChi： | InChI=1S/C13H24N2O2/c1-13(2,3)17-12(16)15-8-4-5-11(15)10-6-7-14-9-10/h10-11,14H,4-9H2,1-3H3 |
| InChiKey： | InChIKey=SWXKQKRTYYRLEM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
