* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX170028-001 |
English Synonyms: | WUXIAPPTEC WX170028-001 ; WUXIAPPTEC WX170028-005 ; WUXIAPPTEC WX170028-010 |
MDL Number.: | MFCD17017068 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CCC(CC1)N1CCC(C1)C(O)=O |
InChi: | InChI=1S/C15H26N2O4/c1-15(2,3)21-14(20)16-8-5-12(6-9-16)17-7-4-11(10-17)13(18)19/h11-12H,4-10H2,1-3H3,(H,18,19) |
InChiKey: | InChIKey=ZYEHIQMGCOCHFN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.