* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105360-001 |
English Synonyms: | WUXIAPPTEC WX105360-001 ; WUXIAPPTEC WX105360-005 ; WUXIAPPTEC WX105360-010 |
MDL Number.: | MFCD17017111 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1=CN2CC3(CCNCC3)OCC2=NC1=O |
InChi: | InChI=1S/C14H19N3O4/c1-2-20-13(19)10-7-17-9-14(3-5-15-6-4-14)21-8-11(17)16-12(10)18/h7,15H,2-6,8-9H2,1H3 |
InChiKey: | InChIKey=AMOHFOQJRVWDQH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.