* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX165079-001 |
English Synonyms: | WUXIAPPTEC WX165079-010 ; WUXIAPPTEC WX165079-005 ; WUXIAPPTEC WX165079-001 |
MDL Number.: | MFCD17017115 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | BrC1CCC2=NN=C(C3CCNC3)N2C1 |
InChi: | InChI=1S/C10H15BrN4/c11-8-1-2-9-13-14-10(15(9)6-8)7-3-4-12-5-7/h7-8,12H,1-6H2 |
InChiKey: | InChIKey=LRTJZYMXQNEJMZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.