* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX165082-001 |
English Synonyms: | WUXIAPPTEC WX165082-005 ; WUXIAPPTEC WX165082-001 ; WUXIAPPTEC WX165082-010 |
MDL Number.: | MFCD17017122 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | BrC1=CN2C=NC(C3CCCNC3)=C2C=C1 |
InChi: | InChI=1S/C12H14BrN3/c13-10-3-4-11-12(15-8-16(11)7-10)9-2-1-5-14-6-9/h3-4,7-9,14H,1-2,5-6H2 |
InChiKey: | InChIKey=OFRPMWRDBNFMPX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.