* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX165090-001 |
| English Synonyms: | WUXIAPPTEC WX165090-010 ; WUXIAPPTEC WX165090-005 ; WUXIAPPTEC WX165090-001 |
| MDL Number.: | MFCD17017132 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | BrC1=CN2N=NC(C3CCNCC3)=C2C=C1 |
| InChi: | InChI=1S/C11H13BrN4/c12-9-1-2-10-11(14-15-16(10)7-9)8-3-5-13-6-4-8/h1-2,7-8,13H,3-6H2 |
| InChiKey: | InChIKey=RNQZKUMJQHBASP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.