* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX140087-001 |
| English Synonyms: | WUXIAPPTEC WX140087-005 ; WUXIAPPTEC WX140087-001 ; WUXIAPPTEC WX140087-010 |
| MDL Number.: | MFCD17017147 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | NCC1CNC2=C(C1)NC=N2 |
| InChi: | InChI=1S/C7H12N4/c8-2-5-1-6-7(9-3-5)11-4-10-6/h4-5,9H,1-3,8H2,(H,10,11) |
| InChiKey: | InChIKey=IGVMRIJDQMIVFP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.