* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110309-001 |
| English Synonyms: | WUXIAPPTEC WX110309-005 ; WUXIAPPTEC WX110309-001 ; WUXIAPPTEC WX110309-010 |
| MDL Number.: | MFCD17017156 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | [H][C@@]12CN(C[C@]1(CN)CC(=O)N2)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C12H21N3O3/c1-11(2,3)18-10(17)15-5-8-12(6-13,7-15)4-9(16)14-8/h8H,4-7,13H2,1-3H3,(H,14,16)/t8-,12-/m1/s1 |
| InChiKey: | InChIKey=WLHDKBVJPXSUDW-PRHODGIISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.