* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX140101-001 |
English Synonyms: | WUXIAPPTEC WX140101-001 ; WUXIAPPTEC WX140101-010 ; WUXIAPPTEC WX140101-005 |
MDL Number.: | MFCD17017163 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | OCC1CNC2=C(C1)NC=N2 |
InChi: | InChI=1S/C7H11N3O/c11-3-5-1-6-7(8-2-5)10-4-9-6/h4-5,8,11H,1-3H2,(H,9,10) |
InChiKey: | InChIKey=FUPNFJRJMQQCRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.