* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX140102-001 |
| English Synonyms: | WUXIAPPTEC WX140102-001 ; WUXIAPPTEC WX140102-010 ; WUXIAPPTEC WX140102-005 |
| MDL Number.: | MFCD17017164 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1C(CO)CCC2=C1C(I)=NN2 |
| InChi: | InChI=1S/C12H18IN3O3/c1-12(2,3)19-11(18)16-7(6-17)4-5-8-9(16)10(13)15-14-8/h7,17H,4-6H2,1-3H3,(H,14,15) |
| InChiKey: | InChIKey=QVTKKGFKDTXWAT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.