* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX140103-001 |
| English Synonyms: | WUXIAPPTEC WX140103-001 ; WUXIAPPTEC WX140103-005 ; WUXIAPPTEC WX140103-010 |
| MDL Number.: | MFCD17017165 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | OCC1=CC2=C(COCCN2)N1 |
| InChi: | InChI=1S/C8H12N2O2/c11-4-6-3-7-8(10-6)5-12-2-1-9-7/h3,9-11H,1-2,4-5H2 |
| InChiKey: | InChIKey=YKFQLCQDGJWNQM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.