* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH925559 |
English Synonyms: | FCHGROUP FCH925559 |
MDL Number.: | MFCD17017170 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C1CC2C(C1CN)OCCN2 |
InChi: | InChI=1S/C8H16N2O/c9-5-6-1-2-7-8(6)11-4-3-10-7/h6-8,10H,1-5,9H2 |
InChiKey: | InChIKey=SWASWUKOBCCJFA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.