* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX140106-001 |
| English Synonyms: | WUXIAPPTEC WX140106-001 ; WUXIAPPTEC WX140106-005 ; WUXIAPPTEC WX140106-010 |
| MDL Number.: | MFCD17017171 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | NCC1=NC2=C(CCCN2)N1 |
| InChi: | InChI=1S/C7H12N4/c8-4-6-10-5-2-1-3-9-7(5)11-6/h9H,1-4,8H2,(H,10,11) |
| InChiKey: | InChIKey=XIPFTOKDSZGVLD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.