* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX140108-001 |
English Synonyms: | WUXIAPPTEC WX140108-010 ; WUXIAPPTEC WX140108-005 ; WUXIAPPTEC WX140108-001 |
MDL Number.: | MFCD17017173 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | NCC1=CC2=C(COCCN2)N1 |
InChi: | InChI=1S/C8H13N3O/c9-4-6-3-7-8(11-6)5-12-2-1-10-7/h3,10-11H,1-2,4-5,9H2 |
InChiKey: | InChIKey=MCVDBEBHOIMHNR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.