* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX120171-001 |
| English Synonyms: | WUXIAPPTEC WX120171-005 ; WUXIAPPTEC WX120171-010 ; WUXIAPPTEC WX120171-001 |
| MDL Number.: | MFCD17017207 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C2CCC1(CN)CC2 |
| InChi: | InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-9-4-6-12(14,8-13)7-5-9/h9H,4-8,13H2,1-3H3 |
| InChiKey: | InChIKey=WKMITBBEIJTYRX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.