* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110323-001 |
| English Synonyms: | WUXIAPPTEC WX110323-001 ; WUXIAPPTEC WX110323-005 ; WUXIAPPTEC WX110323-010 |
| MDL Number.: | MFCD17017211 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | [H][C@]12CN(C[C@@]1([H])[C@H](CO)N(C2)C(=O)OCC1=CC=CC=C1)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C20H28N2O5/c1-20(2,3)27-18(24)21-9-15-10-22(17(12-23)16(15)11-21)19(25)26-13-14-7-5-4-6-8-14/h4-8,15-17,23H,9-13H2,1-3H3/t15-,16-,17+/m1/s1 |
| InChiKey: | InChIKey=FZXXJTYCPIQUOE-ZACQAIPSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.