* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX110326-001 |
English Synonyms: | WUXIAPPTEC WX110326-005 ; WUXIAPPTEC WX110326-001 ; WUXIAPPTEC WX110326-010 |
MDL Number.: | MFCD17017215 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | NCC1CN2C[C@H](O)C[C@H]2CO1 |
InChi: | InChI=1S/C8H16N2O2/c9-2-8-4-10-3-7(11)1-6(10)5-12-8/h6-8,11H,1-5,9H2/t6-,7+,8?/m0/s1 |
InChiKey: | InChIKey=DWTPHABVWYZNKZ-KJFJCRTCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.