* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX120173-001 |
| English Synonyms: | WUXIAPPTEC WX120173-010 ; WUXIAPPTEC WX120173-001 ; WUXIAPPTEC WX120173-005 |
| MDL Number.: | MFCD17017217 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)N1C2C[C@@H](O)C(C2)[C@H]1CN |
| InChi: | InChI=1S/C12H22N2O3/c1-12(2,3)17-11(16)14-7-4-8(9(14)6-13)10(15)5-7/h7-10,15H,4-6,13H2,1-3H3/t7?,8?,9-,10-/m1/s1 |
| InChiKey: | InChIKey=OQGWDJODIGMNDC-YDYPAMBWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.