* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX105366-001 |
English Synonyms: | WUXIAPPTEC WX105366-001 ; WUXIAPPTEC WX105366-010 ; WUXIAPPTEC WX105366-005 |
MDL Number.: | MFCD17017229 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | OC(=O)C1CN(C1)C1=NOC2(CCN(C2)C(=O)OCC2=CC=CC=C2)C1 |
InChi: | InChI=1S/C18H21N3O5/c22-16(23)14-9-21(10-14)15-8-18(26-19-15)6-7-20(12-18)17(24)25-11-13-4-2-1-3-5-13/h1-5,14H,6-12H2,(H,22,23) |
InChiKey: | InChIKey=OMVOHFMYFRBOPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.