* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX135050-001 |
English Synonyms: | WUXIAPPTEC WX135050-005 ; WUXIAPPTEC WX135050-001 ; WUXIAPPTEC WX135050-010 |
MDL Number.: | MFCD17017239 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | ClC1=NC2=C(C=C1)C(Cl)=NC1=C2C=NN1 |
InChi: | InChI=1S/C9H4Cl2N4/c10-6-2-1-4-7(13-6)5-3-12-15-9(5)14-8(4)11/h1-3H,(H,12,14,15) |
InChiKey: | InChIKey=CWMWWXQQYSTLCI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.