* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX145098-001 |
| English Synonyms: | WUXIAPPTEC WX145098-001 ; WUXIAPPTEC WX145098-010 ; WUXIAPPTEC WX145098-005 |
| MDL Number.: | MFCD17017241 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | ClC1=NC2=C(C=C1)C(=O)NC1=C(C2)C=NN1 |
| InChi: | InChI=1S/C10H7ClN4O/c11-8-2-1-6-7(13-8)3-5-4-12-15-9(5)14-10(6)16/h1-2,4H,3H2,(H2,12,14,15,16) |
| InChiKey: | InChIKey=YGSVDUFBUNKDBL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.