* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX145102-001 |
| English Synonyms: | WUXIAPPTEC WX145102-010 ; WUXIAPPTEC WX145102-001 ; WUXIAPPTEC WX145102-005 |
| MDL Number.: | MFCD17017245 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | ClC1=NC2=C(CNC3=C(C2)C=NN3)C=N1 |
| InChi: | InChI=1S/C9H8ClN5/c10-9-12-3-6-2-11-8-5(4-13-15-8)1-7(6)14-9/h3-4H,1-2H2,(H2,11,13,15) |
| InChiKey: | InChIKey=RDLDZNAIILPWRZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.