* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105369-001 |
| English Synonyms: | WUXIAPPTEC WX105369-010 ; WUXIAPPTEC WX105369-001 ; WUXIAPPTEC WX105369-005 |
| MDL Number.: | MFCD17017246 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | O=C(OCC1=CC=CC=C1)N1CCC2(C1)CC1CNCC1C(=O)N2 |
| InChi: | InChI=1S/C18H23N3O3/c22-16-15-10-19-9-14(15)8-18(20-16)6-7-21(12-18)17(23)24-11-13-4-2-1-3-5-13/h1-5,14-15,19H,6-12H2,(H,20,22) |
| InChiKey: | InChIKey=ORQUQIRXDGDEBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.