* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115204-001 |
| English Synonyms: | WUXIAPPTEC WX115204-001 ; WUXIAPPTEC WX115204-005 ; WUXIAPPTEC WX115204-010 |
| MDL Number.: | MFCD17017252 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)C1=C(CN2C(=O)OCC2=CC=CC=C2)C=NN1 |
| InChi: | InChI=1S/C21H26N4O4/c1-21(2,3)29-19(26)24-11-16-17(12-24)25(10-15-9-22-23-18(15)16)20(27)28-13-14-7-5-4-6-8-14/h4-9,16-17H,10-13H2,1-3H3,(H,22,23)/t16-,17+/m0/s1 |
| InChiKey: | InChIKey=ZIDIKVXUYGANLY-DLBZAZTESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.