* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115210-001 |
| English Synonyms: | WUXIAPPTEC WX115210-010 ; WUXIAPPTEC WX115210-001 ; WUXIAPPTEC WX115210-005 |
| MDL Number.: | MFCD17017258 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H]1C1=C(C=NN1)N2C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C20H24N4O4/c1-20(2,3)28-18(25)23-10-9-14-17(23)16-15(11-21-22-16)24(14)19(26)27-12-13-7-5-4-6-8-13/h4-8,11,14,17H,9-10,12H2,1-3H3,(H,21,22)/t14-,17+/m1/s1 |
| InChiKey: | InChIKey=RCPANNKTQQJGOM-PBHICJAKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.