* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115212-001 |
| English Synonyms: | WUXIAPPTEC WX115212-005 ; WUXIAPPTEC WX115212-001 ; WUXIAPPTEC WX115212-010 |
| MDL Number.: | MFCD17017260 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2C(C1)C1=C(C=NN1)N2C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C21H26N4O4/c1-21(2,3)29-19(26)24-10-9-16-15(12-24)18-17(11-22-23-18)25(16)20(27)28-13-14-7-5-4-6-8-14/h4-8,11,15-16H,9-10,12-13H2,1-3H3,(H,22,23) |
| InChiKey: | InChIKey=FQUOCBLJVUDQCK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.