* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115214-001 |
| English Synonyms: | WUXIAPPTEC WX115214-001 ; WUXIAPPTEC WX115214-010 ; WUXIAPPTEC WX115214-005 |
| MDL Number.: | MFCD17017269 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC(C)(C)OC(=O)N1CC2COC3=C(SC(Br)=N3)C2C1 |
| InChi: | InChI=1S/C13H17BrN2O3S/c1-13(2,3)19-12(17)16-4-7-6-18-10-9(8(7)5-16)20-11(14)15-10/h7-8H,4-6H2,1-3H3 |
| InChiKey: | InChIKey=KUVZWBIYONUDEM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.