* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115218-001 |
| English Synonyms: | WUXIAPPTEC WX115218-001 ; WUXIAPPTEC WX115218-010 ; WUXIAPPTEC WX115218-005 |
| MDL Number.: | MFCD17017273 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | OC(=O)C1CC2=C(SC=N2)C2CNCCN12 |
| InChi: | InChI=1S/C10H13N3O2S/c14-10(15)7-3-6-9(16-5-12-6)8-4-11-1-2-13(7)8/h5,7-8,11H,1-4H2,(H,14,15) |
| InChiKey: | InChIKey=FVNPIILGHWTCAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.