* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX145103-001 |
| English Synonyms: | WUXIAPPTEC WX145103-010 ; WUXIAPPTEC WX145103-001 ; WUXIAPPTEC WX145103-005 |
| MDL Number.: | MFCD17017282 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CSC1=NC=C2C3=C(COC2=N1)NN=C3 |
| InChi: | InChI=1S/C9H8N4OS/c1-15-9-10-2-6-5-3-11-13-7(5)4-14-8(6)12-9/h2-3H,4H2,1H3,(H,11,13) |
| InChiKey: | InChIKey=TXQMJLJWDKSXEI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.