* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH925573 |
| English Synonyms: | FCHGROUP FCH925573 |
| MDL Number.: | MFCD17017283 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1c-2c([nH]n1)COc3c2cn[nH]3 |
| InChi: | InChI=1S/C7H6N4O/c1-4-5-2-9-11-7(5)12-3-6(4)10-8-1/h1-2H,3H2,(H,8,10)(H,9,11) |
| InChiKey: | InChIKey=QXIYSDOXULRECH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.