* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX145106-001 |
| English Synonyms: | WUXIAPPTEC WX145106-001 ; WUXIAPPTEC WX145106-010 ; WUXIAPPTEC WX145106-005 |
| MDL Number.: | MFCD17017285 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C1CC2=C(SC=N2)C2=C1NN=C2 |
| InChi: | InChI=1S/C8H7N3S/c1-2-7-8(12-4-9-7)5-3-10-11-6(1)5/h3-4H,1-2H2,(H,10,11) |
| InChiKey: | InChIKey=CVJSBJMQXMFODN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.