* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX145107-001 |
English Synonyms: | WUXIAPPTEC WX145107-010 ; WUXIAPPTEC WX145107-005 ; WUXIAPPTEC WX145107-001 |
MDL Number.: | MFCD17017286 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C1CC2=C(N=CN2)C2=C1NN=C2 |
InChi: | InChI=1S/C8H8N4/c1-2-7-8(10-4-9-7)5-3-11-12-6(1)5/h3-4H,1-2H2,(H,9,10)(H,11,12) |
InChiKey: | InChIKey=GWVCYINKJKFIFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.