* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX145111-001 |
English Synonyms: | WUXIAPPTEC WX145111-005 ; WUXIAPPTEC WX145111-010 ; WUXIAPPTEC WX145111-001 |
MDL Number.: | MFCD17017296 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | ClC1=NC2=C(COC3=C2SC=N3)C(Cl)=N1 |
InChi: | InChI=1S/C8H3Cl2N3OS/c9-6-3-1-14-7-5(15-2-11-7)4(3)12-8(10)13-6/h2H,1H2 |
InChiKey: | InChIKey=BUMKQPNYTBCOSD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.