* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1352043 |
| English Synonyms: | FCHGROUP FCH1352043 |
| MDL Number.: | MFCD17017298 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C1c2c(nc(s2)Br)OCC1N |
| InChi: | InChI=1S/C6H7BrN2OS/c7-6-9-5-4(11-6)1-3(8)2-10-5/h3H,1-2,8H2 |
| InChiKey: | InChIKey=GUXHFLZCHLBASS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.