* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110332-001 |
| English Synonyms: | WUXIAPPTEC WX110332-010 ; WUXIAPPTEC WX110332-005 ; WUXIAPPTEC WX110332-001 |
| MDL Number.: | MFCD17017301 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2OCCNCC2(C)C1 |
| InChi: | InChI=1S/C13H24N2O3/c1-12(2,3)18-11(16)15-7-10-13(4,9-15)8-14-5-6-17-10/h10,14H,5-9H2,1-4H3 |
| InChiKey: | InChIKey=GRWVMQFPCFKBRF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.