* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX125089-001 |
| English Synonyms: | WUXIAPPTEC WX125089-001 ; WUXIAPPTEC WX125089-005 ; WUXIAPPTEC WX125089-010 |
| MDL Number.: | MFCD17017307 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2CC1[C@]1(CNC(=O)C1)O2 |
| InChi: | InChI=1S/C13H20N2O4/c1-12(2,3)19-11(17)15-6-8-4-9(15)13(18-8)5-10(16)14-7-13/h8-9H,4-7H2,1-3H3,(H,14,16)/t8?,9?,13-/m0/s1 |
| InChiKey: | InChIKey=PYPGMJFKXADAND-RPTIHFLNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.