* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX145126-001 |
English Synonyms: | WUXIAPPTEC WX145126-010 ; WUXIAPPTEC WX145126-005 ; WUXIAPPTEC WX145126-001 |
MDL Number.: | MFCD17017314 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | ClC1=NC2=C(C=C1)N=C1CN(CCN21)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C17H15ClN4O2/c18-14-7-6-13-16(20-14)22-9-8-21(10-15(22)19-13)17(23)24-11-12-4-2-1-3-5-12/h1-7H,8-11H2 |
InChiKey: | InChIKey=CFSWZFHWFJDKCY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.