* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1352047 |
| English Synonyms: | FCHGROUP FCH1352047 |
| MDL Number.: | MFCD17017319 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(nc2c1nc3n2CCC3N)Cl |
| InChi: | InChI=1S/C9H9ClN4/c10-7-2-1-6-9(13-7)14-4-3-5(11)8(14)12-6/h1-2,5H,3-4,11H2 |
| InChiKey: | InChIKey=OUFSOZOBVGTLMD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.