* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX140143-001 |
| English Synonyms: | WUXIAPPTEC WX140143-010 ; WUXIAPPTEC WX140143-001 ; WUXIAPPTEC WX140143-005 |
| MDL Number.: | MFCD17017326 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | NC1=CN=C2C(OCCN12)C(O)=O |
| InChi: | InChI=1S/C7H9N3O3/c8-4-3-9-6-5(7(11)12)13-2-1-10(4)6/h3,5H,1-2,8H2,(H,11,12) |
| InChiKey: | InChIKey=FTIZTMNQIJFIMR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.