* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX145140-001 |
English Synonyms: | WUXIAPPTEC WX145140-001 ; WUXIAPPTEC WX145140-010 ; WUXIAPPTEC WX145140-005 |
MDL Number.: | MFCD17017337 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | OC(=O)C1CCN2C(C1)=NC1=C2N=CN=C1Cl |
InChi: | InChI=1S/C10H9ClN4O2/c11-8-7-9(13-4-12-8)15-2-1-5(10(16)17)3-6(15)14-7/h4-5H,1-3H2,(H,16,17) |
InChiKey: | InChIKey=NRLMAFGKCGNPSV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.