* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX145141-001 |
| English Synonyms: | WUXIAPPTEC WX145141-010 ; WUXIAPPTEC WX145141-005 ; WUXIAPPTEC WX145141-001 |
| MDL Number.: | MFCD17017338 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | OC(=O)C1CN2C(CN1C(=O)OCC1=CC=CC=C1)=NC1=C2N=C(Cl)N=C1 |
| InChi: | InChI=1S/C17H14ClN5O4/c18-16-19-6-11-14(21-16)23-7-12(15(24)25)22(8-13(23)20-11)17(26)27-9-10-4-2-1-3-5-10/h1-6,12H,7-9H2,(H,24,25) |
| InChiKey: | InChIKey=KOWSOGUXWZJUBT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.