* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX145143-001 |
| English Synonyms: | WUXIAPPTEC WX145143-010 ; WUXIAPPTEC WX145143-001 ; WUXIAPPTEC WX145143-005 |
| MDL Number.: | MFCD17017340 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | OC(=O)C1OCCN2C1=NC1=C2N=C(Cl)N=C1 |
| InChi: | InChI=1S/C9H7ClN4O3/c10-9-11-3-4-6(13-9)14-1-2-17-5(8(15)16)7(14)12-4/h3,5H,1-2H2,(H,15,16) |
| InChiKey: | InChIKey=OUVJTTFJACYZMD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.