* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX125113-001 |
English Synonyms: | WUXIAPPTEC WX125113-005 ; WUXIAPPTEC WX125113-001 ; WUXIAPPTEC WX125113-010 |
MDL Number.: | MFCD17017370 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(C)(C)OC(=O)N1CCC23OC(CC(=O)C12)C=C3 |
InChi: | InChI=1S/C14H19NO4/c1-13(2,3)19-12(17)15-7-6-14-5-4-9(18-14)8-10(16)11(14)15/h4-5,9,11H,6-8H2,1-3H3 |
InChiKey: | InChIKey=ROWGTHDHBMGREW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.