* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX125120-001 |
English Synonyms: | WUXIAPPTEC WX125120-005 ; WUXIAPPTEC WX125120-010 ; WUXIAPPTEC WX125120-001 |
MDL Number.: | MFCD17017380 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)[C@]12CCC[C@@]3(CNC1)CC=CCOC23 |
InChi: | InChI=1S/C15H23NO3/c1-2-18-13(17)15-8-5-7-14(10-16-11-15)6-3-4-9-19-12(14)15/h3-4,12,16H,2,5-11H2,1H3/t12?,14-,15-/m1/s1 |
InChiKey: | InChIKey=SAZMPNWHYYINNB-JENMUQSASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.