* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115235-001 |
| English Synonyms: | WUXIAPPTEC WX115235-005 ; WUXIAPPTEC WX115235-001 ; WUXIAPPTEC WX115235-010 |
| MDL Number.: | MFCD17017384 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | O=CC1=CN=C2[C@@H]3OCCN(C3CCN12)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C18H19N3O4/c22-11-14-10-19-17-16-15(6-7-20(14)17)21(8-9-24-16)18(23)25-12-13-4-2-1-3-5-13/h1-5,10-11,15-16H,6-9,12H2/t15?,16-/m1/s1 |
| InChiKey: | InChIKey=QLSOGDSFMUUBSG-OEMAIJDKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.