* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115243-001 |
| English Synonyms: | WUXIAPPTEC WX115243-005 ; WUXIAPPTEC WX115243-001 ; WUXIAPPTEC WX115243-010 |
| MDL Number.: | MFCD17017394 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | OC(=O)C1=NC=C2[C@@H]3OCCN([C@@H]3CN12)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C17H17N3O5/c21-16(22)15-18-8-12-14-13(9-20(12)15)19(6-7-24-14)17(23)25-10-11-4-2-1-3-5-11/h1-5,8,13-14H,6-7,9-10H2,(H,21,22)/t13-,14+/m1/s1 |
| InChiKey: | InChIKey=PJYWSYBJQYAXGE-KGLIPLIRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.