* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115248-001 |
| English Synonyms: | WUXIAPPTEC WX115248-001 ; WUXIAPPTEC WX115248-010 ; WUXIAPPTEC WX115248-005 |
| MDL Number.: | MFCD17017399 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | O=CC1=C2[C@@H]3OCCN([C@@H]3CN2C=N1)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C17H17N3O4/c21-9-13-15-16-14(8-19(15)11-18-13)20(6-7-23-16)17(22)24-10-12-4-2-1-3-5-12/h1-5,9,11,14,16H,6-8,10H2/t14-,16-/m1/s1 |
| InChiKey: | InChIKey=GWCOMJXZYMPDBV-GDBMZVCRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.